CAS 3774-64-9: Questin
Description:Questin, with the CAS number 3774-64-9, is a chemical compound that belongs to the class of flavonoids, specifically a flavonol. It is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Questin is known for its potential health benefits, including anti-inflammatory and antimicrobial activities. The compound is often studied for its role in various biological processes and its potential applications in pharmaceuticals and nutraceuticals. In terms of solubility, flavonoids like Questin typically exhibit varying degrees of solubility in polar solvents, which can influence their bioavailability and efficacy. Additionally, Questin may be found in certain plant sources, contributing to the overall health benefits associated with those plants. As with many flavonoids, further research is ongoing to fully elucidate its mechanisms of action and potential therapeutic uses.
Formula:C16H12O5
InChI:InChI=1S/C16H12O5/c1-7-3-9-13(11(18)4-7)16(20)14-10(15(9)19)5-8(17)6-12(14)21-2/h3-6,17-18H,1-2H3
InChI key:InChIKey=UUNPIWCQMVNINR-UHFFFAOYSA-N
SMILES:O=C1C=2C=C(O)C=C(OC)C2C(=O)C3=C(O)C=C(C=C13)C
- Synonyms:
- 1,6-Dihydroxy-8-methoxy-3-methyl-9,10-anthracenedione
- 1,6-Dihydroxy-8-methoxy-3-methylanthraquinone
- 9,10-Anthracenedione, 1,6-dihydroxy-8-methoxy-3-methyl-
- Anthraquinone, 1,6-dihydroxy-8-methoxy-3-methyl-
- C 3368B
- Methylemodin
- Methylemodine
- Questin
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 9,10-Anthracenedione,1,6-dihydroxy-8-methoxy-3-methyl- REF: IN-DA0077Z0CAS: 3774-64-9 | 95% | To inquire | Mon 14 Apr 25 |
![]() | Questin REF: TM-TN2131CAS: 3774-64-9 | 98% | To inquire | Tue 15 Apr 25 |
![]() | Questin REF: 3D-DAA77464CAS: 3774-64-9 | Min. 95% | To inquire | Fri 25 Apr 25 |

9,10-Anthracenedione,1,6-dihydroxy-8-methoxy-3-methyl-
Ref: IN-DA0077Z0
5mg | To inquire |

Questin
Ref: TM-TN2131
5mg | 772.00 € | ||
1mL*10mM (DMSO) | 1,214.00 € |

Questin
Ref: 3D-DAA77464
Undefined size | To inquire |