CAS 37748-09-7

(3-formylphenoxy)acetic acid

Description:

(3-Formylphenoxy)acetic acid, with the CAS number 37748-09-7, is an organic compound characterized by the presence of both an aldehyde and a carboxylic acid functional group. This compound features a phenoxy group, which is a phenyl ring bonded to an oxygen atom, and an acetic acid moiety, contributing to its reactivity and potential applications in organic synthesis. The presence of the formyl group (–CHO) allows for further functionalization, making it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its solubility in polar solvents, such as water and alcohols, is influenced by the carboxylic acid group, while the aromatic ring contributes to its stability and potential for π-π interactions. The compound may exhibit biological activity, which could be explored in medicinal chemistry. Overall, (3-formylphenoxy)acetic acid serves as an important building block in chemical research and development, particularly in the fields of medicinal and synthetic chemistry.

Formula: C₉H₈O₄

InChI: InChI=1/C9H8O4/c10-5-7-2-1-3-8(4-7)13-6-9(11)12/h1-5H,6H2,(H,11,12)

SMILES: c1cc(cc(c1)OCC(=O)O)C=O

Synonyms:

• Acetic acid, 2-(3-formylphenoxy)-

3-Formylphenoxyacetic acid

CAS: 37748-09-7

Formula: C₉H₈O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 180.1574

Ref: IN-DA00BZ0E

3-Formylphenoxyacetic acid

CAS: 37748-09-7

3-Formylphenoxyacetic acid

Purity: 95%

Ref: 54-OR1043601

3-Formylphenoxyacetic acid

CAS: 37748-09-7

3-Formylphenoxyacetic acid

Purity: 97%

Molecular weight: 180.16g/mol

Ref: 54-OR1043409

3-Formylphenoxyacetic acid

CAS: 37748-09-7

3-Formylphenoxyacetic acid is an antibacterial drug that has a high specificity for staphylococcus. This compound is used as a reference compound in the analytical method to measure the antibacterial activity of other compounds. 3-Formylphenoxyacetic acid inhibits bacterial growth by binding to the enzyme ribonucleotide reductase and blocking DNA synthesis. It also reacts with formazans, which are redox indicators that are formed when bacteria are metabolized by aerobic conditions. The presence of these formazans can be detected using a simple colorimetric assay on tissues or bovine serum. 3-Formylphenoxyacetic acid is not active against methicillin-resistant staphylococci, but it works well against heterologous strains such as Salmonella typhimurium and Staphylococcus epidermidis.

Formula: C₉H₈O₄

Purity: Min. 95%

Color and Shape: Off-White Powder

Molecular weight: 180.16 g/mol

Ref: 3D-FF70718

3-Formylphenoxyacetic acid

CAS: 37748-09-7

Formula: C₉H₈O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 180.159

Ref: 10-F342227