CAS 3775-55-1

5-(5-nitrofuran-2-yl)-1,3,4-oxadiazol-2-amine

Description:

5-(5-Nitrofuran-2-yl)-1,3,4-oxadiazol-2-amine is a heterocyclic compound characterized by the presence of both a nitrofuran moiety and an oxadiazole ring. The structure features a five-membered oxadiazole ring, which contains nitrogen and oxygen atoms, contributing to its potential biological activity. The nitrofuran group is known for its antimicrobial properties, making this compound of interest in medicinal chemistry. It typically exhibits moderate to high solubility in organic solvents, while its solubility in water may vary depending on the specific substituents and their interactions. The compound may also display various functional properties, such as fluorescence or reactivity with nucleophiles, due to the presence of the nitro group and the amine functionality. Its potential applications could span from pharmaceuticals to agrochemicals, depending on the biological activity and reactivity profile. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental conditions such as pH and temperature.

Formula: C₆H₄N₄O₄

InChI: InChI=1/C6H4N4O4/c7-6-9-8-5(14-6)3-1-2-4(13-3)10(11)12/h1-2H,(H2,7,9)

SMILES: c1cc(N(=O)=O)oc1c1n[nH]c(=N)o1

Synonyms:

• 1,3,4-Oxadiazol-2-Amine, 5-(5-Nitro-2-Furanyl)-
• 5-(5-Nitro-2-furyl)-1,3,4-oxadiazol-2-amine

5-(5-Nitrofuran-2-yl)-1,3,4-oxadiazol-2-amine

CAS: 3775-55-1

Versatile small molecule scaffold

Formula: C₆H₄N₄O₄

Purity: Min. 95%

Molecular weight: 196.12 g/mol

Ref: 3D-DAA77555