CymitQuimica logo

CAS 37750-33-7

:

4-[(4-bromophenyl)sulfanyl]aniline

Description:
4-[(4-bromophenyl)sulfanyl]aniline, with the CAS number 37750-33-7, is an organic compound characterized by the presence of both an aniline group and a sulfanyl (thioether) moiety. This compound features a bromine atom attached to a phenyl ring, which contributes to its unique chemical properties, including potential reactivity and biological activity. The sulfanyl group introduces a sulfur atom, which can participate in various chemical reactions, such as nucleophilic substitutions or redox processes. The presence of the bromine substituent can enhance the compound's lipophilicity and influence its interaction with biological targets. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, depending on the specific functional groups present. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or materials science due to its structural features, which can facilitate interactions with other molecules. Safety and handling precautions should be observed, as with many organosulfur compounds, due to potential toxicity or reactivity.
Formula:C12H10BrNS
InChI:InChI=1/C12H10BrNS/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H,14H2
Synonyms:
  • 4-(4-Bromo-phenylsulfanyl)-phenylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.