CAS 3776-04-3: (T-4)-Trifluoro(2-propanamine)boron

Description:(T-4)-Trifluoro(2-propanamine)boron, with the CAS number 3776-04-3, is a chemical compound that features a boron atom coordinated to a trifluoro group and a 2-propanamine moiety. This compound is characterized by its unique trifluoromethyl group, which imparts significant electronegativity and influences its reactivity and solubility properties. The presence of the amine group contributes to its potential as a Lewis base, allowing it to participate in various chemical reactions, including coordination with metal ions and other electrophiles. The trifluoromethyl group also enhances the compound's stability and volatility, making it useful in various applications, including organic synthesis and catalysis. Additionally, the compound's properties may be influenced by factors such as temperature and solvent interactions, which can affect its behavior in chemical reactions. Overall, (T-4)-Trifluoro(2-propanamine)boron is notable for its distinctive structural features and reactivity profile, making it of interest in both academic and industrial chemistry contexts.

Formula:C₃H₉BF₃N

InChI:InChI=1S/C3H9BF3N/c1-3(2)8-4(5,6)7/h3H,8H2,1-2H3

InChI key:InChIKey=DNJHXGJLGUPXEO-UHFFFAOYSA-N

SMILES:[F-][B+3]([F-])([F-])[NH2]C(C)C

Synonyms:
(T-4)-Trifluoro(2-propanamine)boron
2-Propanamine, compd. with trifluoroborane (1:1)
Anchor 1115
Anchor Curing Agent 1115
Borane, trifluoro-, compd. with 2-propanamine (1:1)
Boron Fluoride Propan-2-Amine (1:3:1)
Boron fluoride (BF3), compd. with isopropylamine (1:1)
Boron trifluoride-isopropylamine complex
Boron trifluoride-monoisopropylamine complex
Boron, trifluoro(2-propanamine)-, (T-4)-
See more synonyms
Isopropylamine, compd. with BF3
Isopropylamine, compd. with boron fluoride (BF3) (1:1)
Isopropylamine-boron trifluoride complex
Isopropylamine, compd. with boron fluoride (BF3) (1:1)
Isopropylamine, compd. with BF3
Boron fluoride (BF3), compd. with isopropylamine (1:1)
Trifluoro(isopropylamine)boron

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	trifluoro(isopropylamine)boron REF: IN-DA00D01ACAS: 3776-04-3	- - -	To inquire	Tue 08 Apr 25
	Trifluoro(isopropylamine)boron REF: 3D-FT79566CAS: 3776-04-3	Min. 95%	- - -	Discontinued product