CymitQuimica logo

CAS 37760-54-6

:

1,2,4-Oxadiazole-5-carboxylic acid, 3-phenyl-, ethyl ester

Description:
1,2,4-Oxadiazole-5-carboxylic acid, 3-phenyl-, ethyl ester is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its electronic properties and interactions with other molecules. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and drug development. The oxadiazole ring is known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the compound may exhibit specific physical properties such as melting point, boiling point, and solubility, which are essential for its application in various fields, including pharmaceuticals and agrochemicals. Overall, the unique structural features of this compound contribute to its potential utility in diverse chemical applications.
Formula:C11H10N2O3
InChI:InChI=1S/C11H10N2O3/c1-2-15-11(14)10-12-9(13-16-10)8-6-4-3-5-7-8/h3-7H,2H2,1H3
InChI key:InChIKey=GIGKBTJPLNTFON-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=NC(=NO1)C2=CC=CC=C2
Synonyms:
  • 1,2,4-Oxadiazole-5-carboxylic acid, 3-phenyl-, ethyl ester
  • Ethyl 3-phenyl-1,2,4-oxadiazole-5-carboxylate
  • Ethyl 3-phenyl-1,2,4-oxadiazole-5-carboxylate
Found 3 products.