CAS 37777-68-7: (4-chloro-3-nitrophenyl)acetic acid

Description:(4-Chloro-3-nitrophenyl)acetic acid is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with both a chlorine atom and a nitro group, as well as a carboxylic acid functional group. The presence of the chlorine and nitro substituents contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid group, while its aromatic nature may impart some hydrophobic characteristics. The nitro group is known for its electron-withdrawing properties, which can influence the acidity of the carboxylic acid and the overall reactivity of the molecule. Additionally, (4-chloro-3-nitrophenyl)acetic acid may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted for handling and storage, as halogenated and nitro compounds can pose health and environmental risks.

Formula:C₈H₆ClNO₄

InChI:InChI=1/C8H6ClNO4/c9-6-2-1-5(4-8(11)12)3-7(6)10(13)14/h1-3H,4H2,(H,11,12)

Synonyms:
Benzeneacetic Acid, 4-Chloro-3-Nitro-
4-Chloro-3-Nitrophenylacetic Acid
4-Chloro-3-nitrophenylaceticacid

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4-Chloro-3-nitrophenylacetic Acid REF: 3B-C3347CAS: 37777-68-7	>98.0%(T)	119.00 €	Mon 07 Apr 25
4-Chloro-3-nitrophenylacetic acid REF: IN-DA0037ANCAS: 37777-68-7	97%	21.00 €~584.00 €	Mon 14 Apr 25
4-Chloro-3-nitrophenylacetic acid REF: 54-OR4823CAS: 37777-68-7	98%	53.00 €~234.00 €	Mon 21 Apr 25
4-Chloro-3-nitrophenylacetic acid REF: 10-F077899CAS: 37777-68-7	95.0%	To inquire	Thu 24 Apr 25
(4-Chloro-3-nitrophenyl)acetic acid REF: 3D-FC71209CAS: 37777-68-7	Min. 95%	147.00 €~950.00 €	Fri 25 Apr 25