CAS 37777-68-7
:(4-chloro-3-nitrophenyl)acetic acid
Description:
(4-Chloro-3-nitrophenyl)acetic acid is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with both a chlorine atom and a nitro group, as well as a carboxylic acid functional group. The presence of the chlorine and nitro substituents contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid group, while its aromatic nature may impart some hydrophobic characteristics. The nitro group is known for its electron-withdrawing properties, which can influence the acidity of the carboxylic acid and the overall reactivity of the molecule. Additionally, (4-chloro-3-nitrophenyl)acetic acid may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted for handling and storage, as halogenated and nitro compounds can pose health and environmental risks.
Formula:C8H6ClNO4
InChI:InChI=1/C8H6ClNO4/c9-6-2-1-5(4-8(11)12)3-7(6)10(13)14/h1-3H,4H2,(H,11,12)
SMILES:c1cc(c(cc1CC(=O)O)N(=O)=O)Cl
Synonyms:- Benzeneacetic Acid, 4-Chloro-3-Nitro-
- 4-Chloro-3-Nitrophenylacetic Acid
- 4-Chloro-3-nitrophenylaceticacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Chloro-3-nitrophenylacetic Acid
CAS:Formula:C8H6ClNO4Purity:>98.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:215.594-Chloro-3-nitrophenylacetic acid
CAS:Formula:C8H6ClNO4Purity:98%Color and Shape:SolidMolecular weight:215.59054-Chloro-3-nitrophenylacetic acid
CAS:4-Chloro-3-nitrophenylacetic acidPurity:98%Color and Shape:PowderMolecular weight:215.59g/mol(4-Chloro-3-nitrophenyl)acetic acid
CAS:4-Chloro-3-nitrophenylacetic acid (4CNPAA) is a fine chemical that is used as a building block in the synthesis of complex compounds. It is also used as a reagent and intermediate in research and as a speciality chemical. The CAS number for 4-chloro-3-nitrophenylacetic acid is 37777-68-7. The molecular formula for 4CNPAA is C6H4ClNO2. It has the molecular weight of 147.11 and the melting point of 138°C. This compound can be synthesized from phenol, acetic anhydride, and nitric acid. 4CNPAA is soluble in water, ethanol, acetone, ethyl ether, benzene, chloroform, carbon tetrachloride, diethyl ether, and methylene chloride. It also reacts with sodium hydroxide to form sodium salt of 4CNPAA whichFormula:C8H6ClNO4Purity:Min. 95%Molecular weight:215.59 g/mol




