CAS 3779-62-2
:Sinensal
Description:
Sinensal, with the CAS number 3779-62-2, is a chemical compound classified as a sesquiterpene, which is a type of hydrocarbon derived from terpenes. It is primarily found in the essential oils of various plants, particularly in citrus species. Sinensal is characterized by its pleasant, citrus-like aroma, making it valuable in the fragrance and flavoring industries. The compound is known for its potential biological activities, including antimicrobial and antioxidant properties, which have garnered interest in both food preservation and pharmaceutical applications. Sinensal is typically a colorless to pale yellow liquid at room temperature and is soluble in organic solvents. Its stability and reactivity can vary depending on environmental conditions, such as light and temperature. As with many organic compounds, safety precautions should be taken when handling Sinensal, as it may cause irritation upon contact with skin or eyes. Overall, Sinensal represents a significant compound in natural product chemistry with various applications in industry and research.
Formula:C15H22O
InChI:InChI=1S/C15H22O/c1-5-13(2)8-6-9-14(3)10-7-11-15(4)12-16/h5,9,11-12H,1-2,6-8,10H2,3-4H3/b14-9+,15-11+
InChI key:InChIKey=NOPLRNXKHZRXHT-YFVJMOTDSA-N
SMILES:C(=C(/CC/C=C(/C=O)\C)\C)\CCC(C=C)=C
Synonyms:- (2E,6E)-2,6-Dimethyl-10-methylene-2,6,11-dodecatrienal
- 2,6,11-Dodecatrienal, 2,6-dimethyl-10-methylene-, (E,E)-
- 2,6,11-Dodecatrienal,2,6-dimethyl-10-methylene-, (E,E)- (8CI)
- Sinensal
- Sinensal (7CI)
- Tianchengquan
- b-Sinensal
- b-Sinensal, trans-
- trans,trans-2,6-Dimethyl-10-methylene-2,6,11-dodecatrienal
- trans-b-Sinensal
- 2,6,11-Dodecatrienal, 2,6-dimethyl-10-methylene-, (2E,6E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
