CAS 37795-69-0

2,3-dihydro-9H-[1,2]oxazolo[3,2-b]quinazolin-9-one

Description:

2,3-Dihydro-9H-[1,2]oxazolo[3,2-b]quinazolin-9-one is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both oxazole and quinazoline moieties. This compound typically exhibits a fused ring system, which contributes to its potential biological activity and chemical stability. It is often studied for its pharmacological properties, including potential anti-cancer and anti-inflammatory effects. The presence of nitrogen and oxygen atoms in its structure may influence its solubility and reactivity, making it of interest in medicinal chemistry. Additionally, the compound may display specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Its CAS number, 37795-69-0, allows for precise referencing in chemical databases and literature. Overall, 2,3-dihydro-9H-[1,2]oxazolo[3,2-b]quinazolin-9-one represents a significant class of compounds with diverse applications in research and potential therapeutic uses.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c13-10-7-3-1-2-4-8(7)11-9-5-6-14-12(9)10/h1-4H,5-6H2

SMILES: c1ccc2c(c1)c(=O)n1c(CCO1)n2

Synonyms:

• 9H-isoxazolo[3,2-b]quinazolin-9-one, 2,3-dihydro-

W-2429

CAS: 37795-69-0

W-2429

Purity: ≥98%

Molecular weight: 188.18g/mol

Ref: 54-BUP04937

W-2429

CAS: 37795-69-0

W-2429 is a drug with antipyretic and analgesic properties. It has been shown to have pharmacological properties, including sedative, hypnotic, and anticonvulsant effects. W-2429 is not active against gram-positive bacteria, such as Staphylococcus aureus or Streptococcus pneumoniae.

Formula: C₁₀H₈N₂O₂

Purity: Min. 95%

Molecular weight: 188.18 g/mol

Ref: 3D-MBA79569

W-2429

CAS: 37795-69-0

W-2429 is a non-narcotic analgesic agent.

Formula: C₁₀H₈N₂O₂

Purity: 99.27%

Color and Shape: Solid

Molecular weight: 188.18

Ref: TM-T13963