CAS 37798-08-6: 5-Benzofuranmethanamine
Description:5-Benzofuranmethanamine, identified by its CAS number 37798-08-6, is an organic compound characterized by the presence of a benzofuran moiety attached to a methanamine group. This compound typically exhibits properties associated with both aromatic and amine functionalities, which can influence its reactivity and solubility. Benzofuran derivatives are known for their potential biological activities, including antimicrobial and anti-inflammatory properties, making them of interest in medicinal chemistry. The presence of the amine group suggests that 5-Benzofuranmethanamine may participate in hydrogen bonding, affecting its interactions in various chemical environments. Additionally, the compound's structure may allow for various substitution reactions, enabling the synthesis of derivatives with tailored properties. Its stability, solubility, and reactivity can vary based on the specific conditions and solvents used. Overall, 5-Benzofuranmethanamine represents a versatile scaffold for further chemical exploration and potential applications in pharmaceuticals and materials science.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5H,6,10H2
InChI key:InChIKey=OFMIMSPBHXZKRI-UHFFFAOYSA-N
SMILES:O1C=CC=2C=C(C=CC12)CN
- Synonyms:
- ((Benzo[b]furan-5-ylmethyl)amine
- (1-Benzofuran-5-yl)methanamine
- (Benzofuran-5-ylmethyl)amine
- 1-(1-Benzofuran-5-Yl)Methanamine
- 1-Benzofuran-5-ylmethanamine
- 5-(Aminomethyl)benzofuran
- 5-Benzofuranmethanamine
- Benzofuran-5-ylmethanamine

Benzofuran-5-ylmethanamine
Ref: IN-DA003M6Q
1g | 231.00 € | ||
100mg | 114.00 € | ||
250mg | 163.00 € |

5-(Aminomethyl)benzo[b]furan
Ref: 54-OR12314
1g | 381.00 € | ||
250mg | 134.00 € |

Benzofuran-5-ylmethanamine
Ref: 10-F233230
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

5-(Aminomethyl)benzo[b]furan
Ref: 3D-MBA79808
5g | 1,778.00 € | ||
500mg | 458.00 € |