CAS 3780-33-4
:2,2-dimethylchroman-4-one
Description:
2,2-Dimethylchroman-4-one, with the CAS number 3780-33-4, is an organic compound belonging to the class of chromanones, which are characterized by a chroman structure with a ketone functional group. This compound features a chroman ring system substituted with two methyl groups at the 2-position and a carbonyl group at the 4-position. It is typically a yellow to light brown solid, exhibiting moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the carbonyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including condensation and oxidation. 2,2-Dimethylchroman-4-one may also exhibit biological activity, making it of interest in medicinal chemistry and natural product synthesis. Its structural features may influence its physical properties, such as melting point and boiling point, as well as its potential applications in pharmaceuticals, agrochemicals, and as a synthetic intermediate in organic chemistry.
Formula:C11H12O2
InChI:InChI=1/C11H12O2/c1-11(2)7-9(12)8-5-3-4-6-10(8)13-11/h3-6H,7H2,1-2H3
SMILES:CC1(C)CC(=O)c2ccccc2O1
Synonyms:- 2,2-Dimethyl-2,3-dihydro-4H-chromen-4-one
- 4H-1-Benzopyran-4-one, 2,3-dihydro-2,2-dimethyl-
- 2,2-Dimethyl-Chroman-4-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,2-Dimethyl-chroman-4-one
CAS:Formula:C11H12O2Purity:98%Color and Shape:SolidMolecular weight:176.21182,2-Dimethyl-chroman-4-one
CAS:Formula:C11H12O2Purity:98%Color and Shape:SolidMolecular weight:176.2152,2-Dimethyl-chroman-4-one
CAS:2,2-Dimethyl-chroman-4-one is a synthetic compound that has been shown to be an antibacterial agent. It is active against many Gram-positive bacteria, including Staphylococcus aureus and Enterococcus faecalis. 2,2-Dimethyl-chroman-4-one also inhibits the activation of the MAP kinase pathway and the synthesis of protein kinase C. The irradiation of 2,2-dimethylchroman-4-one produces a compound which has been shown to have antiinflammatory effects on mesenchymal stromal cells.Formula:C11H12O2Purity:Min. 95%Molecular weight:176.22 g/mol



