CAS 37804-11-8

3-amino-6-chloro-5-(dimethylamino)-N-(3-pyridyl)pyrazine-2-carboxamide hydrochloride

Description:

3-amino-6-chloro-5-(dimethylamino)-N-(3-pyridyl)pyrazine-2-carboxamide hydrochloride, with the CAS number 37804-11-8, is a chemical compound characterized by its complex structure, which includes a pyrazine ring substituted with various functional groups. This compound features an amino group, a chloro substituent, and a dimethylamino group, contributing to its potential biological activity. The presence of the pyridine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit properties such as being a potential inhibitor or modulator in various biochemical pathways, although specific biological activities would depend on further empirical studies. Its synthesis and characterization would involve standard organic chemistry techniques, and it is essential to handle it with care, following appropriate safety protocols due to its chemical nature.

Formula: C₁₂H₁₄Cl₂N₆O

InChI: InChI=1/C12H13ClN6O.ClH/c1-19(2)11-9(13)17-8(10(14)18-11)12(20)16-7-4-3-5-15-6-7;/h3-6H,1-2H3,(H2,14,18)(H,16,20);1H

SMILES: CN(C)c1c(Cl)nc(c(N)n1)C(=Nc1cccnc1)O.Cl

ACDPP hydrochloride

CAS: 37804-11-8

mGlu5 receptor antagonist

Formula: C₁₂H₁₃ClN₆O

Purity: 98%

Color and Shape: Solid

Molecular weight: 292.72

Ref: TM-T22543