CAS 37805-89-3

Uridine, 5-methoxy-4-thio-

Description:

Uridine, 5-methoxy-4-thio- (CAS 37805-89-3) is a modified nucleoside that features a uridine base with specific substitutions that enhance its biochemical properties. This compound contains a methoxy group at the 5-position and a thio group at the 4-position of the uracil ring. These modifications can influence its stability, solubility, and interaction with nucleic acid structures. Uridine derivatives are often studied for their potential roles in cellular metabolism, particularly in RNA synthesis and as precursors in nucleotide metabolism. The presence of the thio group may also impart unique reactivity and biological activity, making it of interest in medicinal chemistry and biochemistry. Additionally, such modifications can affect the compound's ability to cross biological membranes and its overall pharmacokinetic profile. Overall, Uridine, 5-methoxy-4-thio- represents a class of compounds that can provide insights into nucleoside function and therapeutic applications.

Formula: C₁₀H₁₄N₂O₆S

InChI: InChI=1S/C10H14N2O6S/c1-17-4-2-12(10(16)11-8(4)19)9-7(15)6(14)5(3-13)18-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,19)/t5-,6-,7-,9-/m1/s1

InChI key: InChIKey=CETDLENRCPEQAO-JXOAFFINSA-N

SMILES: O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C=C(OC)C(=S)NC2=O

Synonyms:

• 5-Methoxy-4-thiouridine
• Uridine, 5-methoxy-4-thio-

5-Methoxy-4-thiouridine

CAS: 37805-89-3

5-Methoxy-4-thiouridine is a Nucleoside Derivative - Thio-nucleoside, 5-Modified pyrimidine nucleoside.

Formula: C₁₀H₁₄N₂O₆S

Color and Shape: Solid

Molecular weight: 290.29

Ref: TM-TNU0242