CymitQuimica logo

CAS 3781-69-9

:

2-Benzofurancarboxylicacid, 4-hydroxy-3-methyl-, ethyl ester

Description:
2-Benzofurancarboxylic acid, 4-hydroxy-3-methyl-, ethyl ester, with CAS number 3781-69-9, is an organic compound characterized by its ester functional group and a benzofuran structure. This compound features a benzofuran ring fused to a carboxylic acid moiety, which is further substituted with a hydroxy group and a methyl group at specific positions. The presence of the ethyl ester group enhances its solubility in organic solvents and may influence its reactivity and biological activity. Typically, compounds of this nature exhibit moderate to high polarity due to the carboxylic acid and hydroxy functionalities, which can participate in hydrogen bonding. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities. Additionally, its structural features suggest that it could be involved in various chemical reactions, such as esterification or hydrolysis, under appropriate conditions. Overall, the unique combination of functional groups and structural characteristics makes it a compound of interest for further study and application.
Formula:C12H12O4
InChI:InChI=1S/C12H12O4/c1-3-15-12(14)11-7(2)10-8(13)5-4-6-9(10)16-11/h4-6,13H,3H2,1-2H3
InChI key:NBTXBAOGAXOKEV-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(C2=C(C=CC=C2O1)O)C
Synonyms:
  • Ethyl 4-hydroxy-3-methylbenzofuran-2-carboxylate
  • 2-Carbethoxy-4-hydroxy-3-methylbenzofuran
Found 5 products.