CAS 37816-19-6

7,8-Dihydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one

Description:

7,8-Dihydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one, also known by its CAS number 37816-19-6, is a flavonoid compound characterized by its polyphenolic structure. This compound features a benzopyran core with hydroxyl groups at the 7 and 8 positions, contributing to its antioxidant properties. The presence of a methoxyphenyl group at the 3-position enhances its biological activity and solubility. It is typically found in various plant sources and is studied for its potential health benefits, including anti-inflammatory, antimicrobial, and anticancer activities. The compound's molecular structure allows for interactions with various biological targets, making it of interest in pharmacological research. Additionally, its solubility and stability can be influenced by environmental factors, which are important considerations in its application in natural product chemistry and potential therapeutic uses. Overall, 7,8-Dihydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one exemplifies the diverse roles that flavonoids play in both plant biology and human health.

Formula: C₁₆H₁₂O₅

InChI: InChI=1S/C16H12O5/c1-20-10-4-2-9(3-5-10)12-8-21-16-11(14(12)18)6-7-13(17)15(16)19/h2-8,17,19H,1H3

InChI key: InChIKey=DLXIJJURUIXRFK-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=C1C3=CC=C(OC)C=C3)=C(O)C(O)=CC2

Synonyms:

• Isoflavone, 7,8-dihydroxy-4′-methoxy-
• 7,8-Dihydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 7,8-dihydroxy-3-(4-methoxyphenyl)-
• Retusin
• Retusin (Dalbergia)

Astragalus Metabolite 2

CAS: 37816-19-6

Formula: C₁₆H₁₂O₅

Molecular weight: 284.27

Ref: 4Z-A-317002

8'-Hydroxyformononetin

CAS: 37816-19-6

8'-Hydroxyformononetin is a phytoestrogen compound, which is derived from plant sources, particularly from legumes, including red clover and soy. As a naturally occurring isoflavone, it falls within the class of flavonoids, a group of polyphenolic compounds with varied biological activities. Its mode of action primarily involves binding to estrogen receptors, where it can mimic or modulate the action of estrogen in the body. This interaction can result in either estrogenic or anti-estrogenic effects, depending on the presence of endogenous estrogen and other factors within the target tissues.

Formula: C₁₆H₁₂O₅

Purity: Min. 95%

Molecular weight: 284.26 g/mol

Ref: 3D-FH65422

Retusin tlc

CAS: 37816-19-6

Retusin TLC is a flavonoid compound, which is derived from natural plant sources. Flavonoids are known for their diverse biological activities, primarily due to their antioxidant properties. The mode of action of Retusin TLC involves its ability to scavenge free radicals, thereby reducing oxidative stress at the cellular level. This activity plays a crucial role in modulating various biochemical pathways, potentially leading to anti-inflammatory and anti-cancer effects.

Formula: C₁₆H₁₂O₅

Purity: Min. 95%

Molecular weight: 284.26 g/mol

Ref: 3D-FR65445