
CAS 37819-60-6
:8-(Acetyl-9H-fluoren-2-ylamino)-2′-deoxyguanosine
Description:
8-(Acetyl-9H-fluoren-2-ylamino)-2′-deoxyguanosine, with the CAS number 37819-60-6, is a modified nucleoside that incorporates a fluorenyl group into the structure of deoxyguanosine. This compound features an acetylated amino group at the 8-position of the guanine base, which enhances its solubility and stability. The presence of the fluorenyl moiety contributes to its unique optical and electronic properties, making it of interest in various biochemical applications, including studies of nucleic acid interactions and drug design. The modification can influence the compound's ability to participate in hydrogen bonding and base pairing, potentially affecting its biological activity. Additionally, this compound may exhibit fluorescence, which can be utilized in analytical techniques. Its structural characteristics allow for potential applications in molecular biology, particularly in the development of nucleic acid-based therapeutics and probes. Overall, 8-(Acetyl-9H-fluoren-2-ylamino)-2′-deoxyguanosine represents a valuable tool in the field of chemical biology and medicinal chemistry.
Formula:C25H24N6O5
InChI:InChI=1S/C25H24N6O5/c1-12(33)30(15-6-7-17-14(9-15)8-13-4-2-3-5-16(13)17)25-27-21-22(28-24(26)29-23(21)35)31(25)20-10-18(34)19(11-32)36-20/h2-7,9,18-20,32,34H,8,10-11H2,1H3,(H3,26,28,29,35)/t18-,19+,20+/m0/s1
InChI key:InChIKey=QHNMSPBQWLPAMP-XUVXKRRUSA-N
SMILES:N(C(C)=O)(C=1N(C2=C(N1)C(=O)N=C(N)N2)[C@@H]3O[C@H](CO)[C@@H](O)C3)C=4C=C5C(=CC4)C=6C(C5)=CC=CC6
Synonyms:- N-(Deoxyguanosin-8-yl)-2-acetamidofluorene
- Guanosine, 8-(acetyl-9H-fluoren-2-ylamino)-2′-deoxy-
- N-(2′-Deoxyguanosin-8-yl)-2-acetylaminofluorene
- 8-(Acetyl-9H-fluoren-2-ylamino)-2′-deoxyguanosine
- N-(Deoxyguanosin-8-yl)-2-acetylaminofluorene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetylaminofluorene-dG
CAS:Acetylaminofluorene-dG is a carcinogenic adduct which covalently binds DNA bases and promotes mutagenesis near the adduct site.Formula:C25H24N6O5Color and Shape:SolidMolecular weight:488.5
