CAS 378211-85-9

pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

Description:

Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a heterocyclic compound characterized by a fused pyrazole and pyrimidine ring system, which contributes to its unique chemical properties. This compound typically exhibits a carboxylic acid functional group at the 2-position of the pyrimidine ring, influencing its acidity and reactivity. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in the ring structure can enhance its ability to form hydrogen bonds, which is crucial for interactions with biological targets. Additionally, the compound may exhibit moderate solubility in polar solvents, which can affect its bioavailability and pharmacokinetics. Its structural features may also allow for various synthetic modifications, enabling the exploration of derivatives with enhanced or altered biological activities. Overall, pyrazolo[1,5-a]pyrimidine-2-carboxylic acid represents a versatile scaffold in the development of novel therapeutic agents.

Formula: C₇H₅N₃O₂

InChI: InChI=1/C7H5N3O2/c11-7(12)5-4-6-8-2-1-3-10(6)9-5/h1-4H,(H,11,12)

SMILES: c1cnc2cc(C(=O)O)nn2c1

Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

CAS: 378211-85-9

Formula: C₇H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1335

Ref: IN-DA00BYWG

Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

CAS: 378211-85-9

Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

Purity: 98%

Molecular weight: 163.13g/mol

Ref: 54-OR961056

Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

CAS: 378211-85-9

Formula: C₇H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.136

Ref: 10-F401970

Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

CAS: 378211-85-9

Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a high purity chemical substance. It is an antiviral and anticancer agent, which has been shown to inhibit the replication of DNA in vitro. Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid can be used for the synthesis of ribonucleosides, deoxyribonucleosides, nucleoside phosphoramidites, diphosphate and triphosphate. This novel chemical substance is also a potential inhibitor of DNA polymerase and RNA polymerase.

Formula: C₇H₅N₃O₂

Purity: Min. 95%

Molecular weight: 163.13 g/mol

Ref: 3D-NP57366