CAS 378247-75-7

2-[7-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxo-chromen-4-yl]acetic acid

Description:

2-[7-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxo-chromen-4-yl]acetic acid, with the CAS number 378247-75-7, is a synthetic organic compound characterized by its complex structure, which includes a chromen-4-yl moiety and a fluorenylmethoxycarbonyl (Fmoc) group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in medicinal chemistry and drug development. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions, while the Fmoc group is commonly used in peptide synthesis as a protective group for amino acids. The chromen-4-yl structure may impart biological activity, as compounds in this class are often investigated for their pharmacological properties. Additionally, the compound's solubility, stability, and reactivity can vary based on the specific conditions and solvents used, making it a subject of interest for further research in organic synthesis and biological applications.

Formula: C₂₆H₁₉NO₆

InChI: InChI=1/C26H19NO6/c28-24(29)11-15-12-25(30)33-23-13-16(9-10-17(15)23)27-26(31)32-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-10,12-13,22H,11,14H2,(H,27,31)(H,28,29)

SMILES: c1ccc2c(c1)c1ccccc1C2COC(=Nc1ccc2c(CC(=O)O)cc(=O)oc2c1)O

Synonyms:

• 7-N-Fmoc-aminocoumarin-4-acetic acid

2-(7-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-oxo-2H-chromen-4-yl)acetic acid

CAS: 378247-75-7

Formula: C₂₆H₁₉NO₆

Purity: 95%

Color and Shape: Solid

Molecular weight: 441.4322

Ref: IN-DA003A7T

2-(7-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-oxo-2H-chromen-4-yl)acetic acid

CAS: 378247-75-7

2-(7-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-oxo-2H-chromen-4-yl)acetic acid

Purity: 95%

Molecular weight: 441.43g/mol

Ref: 54-OR80867

2-(7-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-oxo-2H-chromen-4-yl)acetic acid

CAS: 378247-75-7

Purity: 95%

Molecular weight: 441.4389953613281

Ref: 10-F624273

Fmoc-Acc-OH

CAS: 378247-75-7

Fmoc-Acc-OH is a proteolytic amino acid with an apical profile. It is used as a building block for peptide synthesis and as a tool for the synthesis of peptides, proteins, and other biomolecules. Fmoc-Acc-OH has been shown to induce apoptosis in cancer cells and viruses. This amino acid also has biochemical properties that include reversine-treated apoptotic signaling and anti-inflammatory activities.

Formula: C₂₆H₁₉NO₆

Purity: Min. 95%

Molecular weight: 441.44 g/mol

Ref: 3D-FAC-1960-PI