CAS 37828-19-6

1-Phenylcyclobutanecarboxylic acid

Description:

1-Phenylcyclobutanecarboxylic acid is an organic compound characterized by its cyclobutane ring structure fused with a phenyl group and a carboxylic acid functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, though its solubility in water is limited due to the hydrophobic nature of the phenyl group. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its molecular structure contributes to its potential applications in organic synthesis and as a building block in pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting physical properties, such as melting and boiling points, which are influenced by its molecular interactions and steric hindrance. Overall, 1-Phenylcyclobutanecarboxylic acid serves as a valuable compound in the field of organic chemistry, with implications for further research and development in various chemical applications.

Formula: C₁₁H₁₁O₂

InChI: InChI=1/C11H12O2/c12-10(13)11(7-4-8-11)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,12,13)/p-1

SMILES: c1ccc(cc1)C1(CCC1)C(=O)[O-]

Synonyms:

• Cyclobutanecarboxylic acid, 1-phenyl-
• 1-Phenylcyclobutanecarboxylate

1-Phenylcyclobutanecarboxylic acid

CAS: 37828-19-6

Formula: C₁₁H₁₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 176.2118

Ref: IN-DA003EMD

1-Phenylcyclobutane-1-carboxylic acid

CAS: 37828-19-6

1-Phenylcyclobutane-1-carboxylic acid

Formula: C₁₁H₁₂O₂

Purity: ≥95%

Color and Shape: white powder

Molecular weight: 176.21g/mol

Ref: 54-OR2270

1-Phenylcyclobutanecarboxylic acid

CAS: 37828-19-6

Formula: C₁₁H₁₂O₂

Purity: 96%

Color and Shape: Solid, White powder

Molecular weight: 176.215

Ref: 10-F065653