CymitQuimica logo

CAS 3783-38-8

:

methyl pyridine-4-carboxylate 1-oxide

Description:
Methyl pyridine-4-carboxylate 1-oxide, with the CAS number 3783-38-8, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylate group and a methyl group attached to the pyridine ring, specifically at the 4-position, along with an oxide functional group. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. Methyl pyridine-4-carboxylate 1-oxide is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the nitrogen atom in the pyridine ring contributes to its basicity and reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, it may exhibit moderate solubility in polar solvents, which can influence its behavior in different chemical environments. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H7NO3
InChI:InChI=1/C7H7NO3/c1-11-7(9)6-2-4-8(10)5-3-6/h2-5H,1H3
InChI key:XSGNXRNOZMUURC-UHFFFAOYSA-N
SMILES:COC(=O)c1ccn(=O)cc1
Synonyms:
  • 4-Pyridinecarboxylic acid, methyl ester, 1-oxide
  • Methyl isonicotinate 1-oxide
Found 6 products.