CAS 37839-63-7
:(1E,6E,8S)-1-methyl-8-(1-methylethyl)-5-methylidenecyclodeca-1,6-diene
Description:
The chemical substance known as (1E,6E,8S)-1-methyl-8-(1-methylethyl)-5-methylidenecyclodeca-1,6-diene, with the CAS number 37839-63-7, is a bicyclic compound characterized by its complex structure featuring multiple double bonds and a cyclodecane framework. This compound exhibits geometric isomerism due to the presence of double bonds, which can exist in either cis or trans configurations. The specific stereochemistry indicated by the (8S) designation suggests a particular spatial arrangement of substituents around the chiral center, influencing its reactivity and interactions. The presence of alkyl groups, such as the methyl and isopropyl groups, contributes to its hydrophobic nature, making it less soluble in polar solvents. This compound may exhibit interesting chemical properties, including potential reactivity in organic synthesis or biological activity, although specific applications would depend on further research. Overall, its unique structure and stereochemistry make it a subject of interest in the fields of organic chemistry and natural product synthesis.
Formula:C15H24
InChI:InChI=1/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h7-8,10,12,15H,3,5-6,9,11H2,1-2,4H3/b10-8+,14-7+/t15-/m0/s1
Synonyms:- (1E,6E,8S)-1-methyl-5-methylidene-8-(propan-2-yl)cyclodeca-1,6-diene
- (1E,6E,8S)-8-Isopropyl-1-methyl-5-methylenecyclodeca-1,6-diene
- 1,6-cyclodecadiene, 1-methyl-5-methylene-8-(1-methylethyl)-, (1E,6E,8S)-
- Germacra-1(10),4(15),5-triene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Germacrene D
CAS:<p>Germacrene D is a sesquiterpene, which is a naturally occurring organic compound. It is sourced primarily from essential oils of various plants, including certain species of Pogostemon and Cannabis. These plants produce a variety of terpenes that contribute to their aromatic properties and potential therapeutic effects.</p>Formula:C15H24Purity:Min. 95%Molecular weight:204.35 g/mol
