
CAS 3784-89-2
:8-Azoniabicyclo[3.2.1]octane, 3-[(2-hydroxy-2-phenylacetyl)oxy]-8-methyl-8-(2-oxo-2-phenylethyl)-, chloride (1:1)
Description:
8-Azoniabicyclo[3.2.1]octane, 3-[(2-hydroxy-2-phenylacetyl)oxy]-8-methyl-8-(2-oxo-2-phenylethyl)-, chloride (1:1), commonly referred to by its CAS number 3784-89-2, is a quaternary ammonium compound characterized by its bicyclic structure and the presence of a positively charged nitrogen atom. This compound features a hydroxyl group and an ester linkage, contributing to its potential reactivity and solubility in polar solvents. The presence of phenyl groups enhances its aromatic character, which may influence its interactions in biological systems. As a chloride salt, it is typically encountered in a solid form and may exhibit hygroscopic properties. Its unique structure suggests potential applications in medicinal chemistry, particularly in drug design, due to the ability to modify its pharmacokinetic properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it of interest in various chemical and pharmaceutical contexts.
Formula:C24H28NO4·Cl
InChI:InChI=1S/C24H28NO4.ClH/c1-25(16-22(26)17-8-4-2-5-9-17)19-12-13-20(25)15-21(14-19)29-24(28)23(27)18-10-6-3-7-11-18;/h2-11,19-21,23,27H,12-16H2,1H3;1H/q+1;/p-1
InChI key:InChIKey=NMWOUJTUPILZRV-UHFFFAOYSA-M
SMILES:C(C(=O)C1=CC=CC=C1)[N+]2(C)C3CC(OC(C(O)C4=CC=CC=C4)=O)CC2CC3.[Cl-]
Synonyms:- 8-Azoniabicyclo[3.2.1]octane, 3-[(hydroxyphenylacetyl)oxy]-8-methyl-8-(2-oxo-2-phenylethyl)-, chloride
- 8-Azoniabicyclo[3.2.1]octane, 3-[(2-hydroxy-2-phenylacetyl)oxy]-8-methyl-8-(2-oxo-2-phenylethyl)-, chloride (1:1)
- ROQ 432
- 8-Phenacylhomatropinium chloride
- 8-Phenacylhomatropine chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
