CAS 3784-97-2
:1-methyl-1,2-dihydropyridine-2-carbaldehyde
Description:
1-Methyl-1,2-dihydropyridine-2-carbaldehyde is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl group and an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a colorless to pale yellow liquid or solid, depending on the conditions. The presence of the aldehyde group makes it a versatile intermediate in various chemical reactions, including condensation and oxidation reactions. Its molecular structure allows for potential interactions with other reagents, making it useful in the synthesis of more complex molecules. Additionally, the compound may exhibit specific physical properties such as boiling and melting points, solubility in organic solvents, and varying degrees of stability under different conditions. As with many nitrogen-containing heterocycles, it may also display interesting biological activities, warranting further investigation in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H9NO
InChI:InChI=1/C7H9NO/c1-8-5-3-2-4-7(8)6-9/h2-7H,1H3
SMILES:CN1C=CC=CC1C=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyridine-2-carboxaldehyde Methiodide
CAS:Controlled ProductFormula:C7H8INOColor and Shape:NeatMolecular weight:249.05
