
CAS 3785-28-2
:2-[(2,2-Dichloroacetyl)[[4-(methylsulfonyl)phenyl]methyl]amino]ethyl 2-bromoacetate
Description:
2-[(2,2-Dichloroacetyl)[[4-(methylsulfonyl)phenyl]methyl]amino]ethyl 2-bromoacetate, with the CAS number 3785-28-2, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups. It features a dichloroacetyl moiety, a sulfonyl group attached to a phenyl ring, and a bromoacetate group, indicating potential reactivity and biological activity. The presence of the sulfonyl group suggests solubility in polar solvents, while the bromoacetate component may impart electrophilic characteristics. This compound is likely to exhibit properties typical of amides and esters, including potential reactivity in nucleophilic substitution reactions. Its intricate structure may also suggest applications in medicinal chemistry, possibly as a lead compound for drug development. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies. Overall, this compound exemplifies the complexity often found in synthetic organic chemistry, with implications for both research and practical applications.
Formula:C14H16BrCl2NO5S
InChI:InChI=1S/C14H16BrCl2NO5S/c1-24(21,22)11-4-2-10(3-5-11)9-18(14(20)13(16)17)6-7-23-12(19)8-15/h2-5,13H,6-9H2,1H3
InChI key:InChIKey=NZOLBUNOTNPNKG-UHFFFAOYSA-N
SMILES:C(N(CCOC(CBr)=O)C(C(Cl)Cl)=O)C1=CC=C(S(C)(=O)=O)C=C1
Synonyms:- Acetic acid, bromo-, ester with 2,2-dichloro-N-(2-hydroxyethyl)-N-[p-(methylsulfonyl)benzyl]acetamide
- M and B 6163
- 2-[(2,2-Dichloroacetyl)[[4-(methylsulfonyl)phenyl]methyl]amino]ethyl 2-bromoacetate
- Acetic acid, 2-bromo-, 2-[(2,2-dichloroacetyl)[[4-(methylsulfonyl)phenyl]methyl]amino]ethyl ester
- Acetic acid, bromo-, 2-[(dichloroacetyl)[[4-(methylsulfonyl)phenyl]methyl]amino]ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetic acid, bromo-, 2-((dichloroacetyl)((4-(methylsulfonyl)phenyl)methyl)amino)ethyl ester
CAS:Acetic acid, bromo-, 2-((dichloroacetyl)((4-(methylsulfonyl)phenyl)methyl)amino)ethyl ester is a bioactive chemical.Formula:C14H16BrCl2NO5SColor and Shape:SolidMolecular weight:461.16
