CAS 37852-39-4

2-(4,5-dimethoxy-2-nitrophenyl)ethanaminium

Description:

2-(4,5-Dimethoxy-2-nitrophenyl)ethanaminium, with the CAS number 37852-39-4, is a chemical compound characterized by its unique structure, which includes a phenyl ring substituted with two methoxy groups and a nitro group, along with an ethanaminium moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in organic solvents due to the presence of methoxy groups, which can enhance its lipophilicity. The nitro group contributes to its electron-withdrawing characteristics, potentially influencing its reactivity and interaction with biological systems. The presence of the ethanaminium group suggests that it may exhibit basic properties, allowing it to participate in protonation reactions. Additionally, compounds of this type may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their structural features that can interact with biological targets. Overall, the compound's characteristics make it a subject of interest in various fields, including organic synthesis and drug development.

Formula: C₁₀H₁₄N₂O₄

InChI: InChI=1/C10H14N2O4/c1-15-9-5-7(3-4-11)8(12(13)14)6-10(9)16-2/h5-6H,3-4,11H2,1-2H3

SMILES: COc1cc(CCN)c(cc1OC)N(=O)=O

Synonyms:

• 4,5-Dimethoxy-2-Nitrophenethylamine
• 2-(4,5-Dimethoxy-2-Nitrophenyl)Ethanamine

2-(4,5-Dimethoxy-2-nitrophenyl)ethan-1-amine

Controlled Product

CAS: 37852-39-4

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂O₄

Purity: Min. 95%

Molecular weight: 226.23 g/mol

Ref: 3D-MBA85239