CAS 37859-42-0
:2-Hydroxymethylbenzothiazole
Description:
2-Hydroxymethylbenzothiazole is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a hydroxymethyl group (-CH2OH) attached to the benzothiazole moiety, contributing to its reactivity and potential applications. It is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. The presence of the hydroxymethyl group enhances its ability to participate in various chemical reactions, making it useful in the synthesis of other organic compounds. 2-Hydroxymethylbenzothiazole is often studied for its potential applications in pharmaceuticals, agrochemicals, and as a chemical intermediate. Additionally, it may exhibit biological activity, which warrants further investigation into its pharmacological properties. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H7NOS
InChI:InChI=1/C8H7NOS/c10-5-8-9-6-3-1-2-4-7(6)11-8/h1-4,10H,5H2
SMILES:c1ccc2c(c1)nc(CO)s2
Synonyms:- 1,3-Benzothiazol-2-ylmethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Benzothiazolemethanol, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H7NOSPurity:97%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:165.212-Hydroxymethylbenzothiazole
CAS:Formula:C8H7NOSPurity:98%Color and Shape:SolidMolecular weight:165.21232-(Hydroxymethyl)-1,3-benzothiazole
CAS:2-(Hydroxymethyl)-1,3-benzothiazoleFormula:C8H7NOSPurity:≥95%Color and Shape: light yellow crystalline powderMolecular weight:165.21g/mol2-Hydroxymethylbenzothiazole
CAS:Formula:C8H7NOSPurity:97%Color and Shape:SolidMolecular weight:165.21



