CAS 37859-43-1
:2-(chloromethyl)-1,3-benzothiazole
Description:
2-(Chloromethyl)-1,3-benzothiazole is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a chloromethyl group (-CH2Cl) attached to the benzothiazole, which can influence its reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chloromethyl group makes it a potential electrophile, allowing it to participate in various chemical reactions, such as nucleophilic substitution. This compound is of interest in the field of medicinal chemistry and materials science, where it may serve as an intermediate in the synthesis of pharmaceuticals or functional materials. Additionally, its unique structure may impart specific biological activities, making it a candidate for further research in drug development. Safety considerations should be taken into account due to the presence of chlorine, which can pose hazards in terms of toxicity and environmental impact.
Formula:C8H6ClNS
InChI:InChI=1/C8H6ClNS/c9-5-8-10-6-3-1-2-4-7(6)11-8/h1-4H,5H2
SMILES:c1ccc2c(c1)nc(CCl)s2
Synonyms:- Benzothiazole, 2-(chloromethyl)-
- 2-(Chloromethyl)Benzothiazole
- 2-(Chloromethyl)-1,3-benzothiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Chloromethyl)benzothiazole
CAS:Formula:C8H6ClNSPurity:>98.0%(GC)Color and Shape:Yellow - Brown Solid FormMolecular weight:183.652-(Chloromethyl)benzothiazole, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H6ClNSPurity:95%Molecular weight:183.652-(Chloromethyl)-1,3-benzothiazole
CAS:Formula:C8H6ClNSPurity:98%Color and Shape:SolidMolecular weight:183.65792-(Chloromethyl)-1,3-benzothiazole
CAS:2-(Chloromethyl)-1,3-benzothiazoleFormula:C8H6ClNSPurity:≥95%Color and Shape:White SolidMolecular weight:183.66g/mol2-(Chloromethyl)-1,3-benzothiazole
CAS:Formula:C8H6ClNSPurity:95%Color and Shape:SolidMolecular weight:183.65




