CAS 37868-26-1
:2-Indanylacetic acid
Description:
2-Indanylacetic acid, with the CAS number 37868-26-1, is an organic compound characterized by its unique structure, which includes an indane ring fused to an acetic acid moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents. It exhibits properties typical of carboxylic acids, such as the ability to form hydrogen bonds and participate in acid-base reactions. The presence of the indane structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. Additionally, 2-Indanylacetic acid may exhibit moderate lipophilicity due to its aromatic nature, influencing its pharmacokinetic properties. Its synthesis often involves the functionalization of indane derivatives, and it may serve as an intermediate in the synthesis of more complex organic molecules. As with many organic compounds, safety precautions should be observed when handling 2-Indanylacetic acid, including the use of appropriate personal protective equipment.
Formula:C11H12O2
InChI:InChI=1/C11H12O2/c12-11(13)7-9-6-5-8-3-1-2-4-10(8)9/h1-4,9H,5-7H2,(H,12,13)
SMILES:c1ccc2c(c1)CCC2CC(=O)O
Synonyms:- 2,3-dihydro-1H-inden-1-ylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Indanylacetic acid, 99%
CAS:<p>2-Indanylacetic acid is the starting material in the synthesis of pentacylic core of (+)-Salvileucalin. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa A</p>Formula:C11H12O2Purity:99%Color and Shape:Crystals or powder or crystalline powder or fused solid, White to cream to brownMolecular weight:176.222-(2,3-Dihydro-1H-inden-2-yl)acetic acid
CAS:Formula:C11H12O2Purity:98%Color and Shape:SolidMolecular weight:176.215
