CAS 3788-06-5: Lachnophyllum ester

Description: Lachnophyllum ester, identified by its CAS number 3788-06-5, is a chemical compound that belongs to the class of esters. Esters are typically formed from the reaction of an alcohol and a carboxylic acid, resulting in a compound characterized by the presence of a carbonyl group (C=O) adjacent to an ether linkage (C-O). Lachnophyllum ester is known for its potential applications in various fields, including organic synthesis and possibly as a flavoring or fragrance agent, although specific applications may vary. The compound may exhibit properties such as volatility, solubility in organic solvents, and stability under certain conditions. Its molecular structure likely influences its reactivity and interactions with other substances. As with many chemical compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, Lachnophyllum ester represents a specific example of the diverse and functional nature of ester compounds in chemistry.

Formula: C₁₁H₁₂O₂

InChI: InChI=1S/C11H12O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h9-10H,3-4H2,1-2H3/b10-9+

InChI key: InChIKey=LWONXTYZMYZRSU-MDZDMXLPSA-N

SMILES: O=C(OC)C=CC#CC#CCCC

Synonyms:

• trans-Lachnophyllum ester
• 2-Decene-4,6-diynoic acid, methyl ester, (E)-
• Lachnophyllum ester
• 2-Decene-4,6-diynoic acid, methyl ester, (2E)-
• (E)-Lachnophyllum ester

trans-Lachnophyllum Ester

CAS: 3788-06-5

• Formula: C₁₁H₁₂O₂
• Molecular weight: 176.22