CAS 37893-02-0
:Flubenzimine
Description:
Flubenzimine is a chemical compound classified as a benzamide derivative, primarily known for its potential applications in pharmacology. It features a distinctive structure that includes a fluorobenzene moiety, contributing to its unique chemical properties. The compound is characterized by its ability to interact with various biological targets, which has led to interest in its use as a therapeutic agent. Flubenzimine exhibits moderate lipophilicity, influencing its absorption and distribution in biological systems. Additionally, it is known to undergo metabolic transformations, which can affect its pharmacokinetics and efficacy. The compound's safety profile and toxicity are important considerations in its development for medicinal use. As with many chemical substances, proper handling and storage conditions are essential to maintain its stability and prevent degradation. Overall, Flubenzimine represents a noteworthy example of the diverse functionalities that can be achieved through the manipulation of chemical structures in drug design.
Formula:C17H10F6N4S
InChI:InChI=1S/C17H10F6N4S/c18-16(19,20)25-13-14(26-17(21,22)23)28-15(24-11-7-3-1-4-8-11)27(13)12-9-5-2-6-10-12/h1-10H
InChI key:InChIKey=IZFZCMFMJKDHJZ-UHFFFAOYSA-N
SMILES:N(C(F)(F)F)=C1N(C(=NC2=CC=CC=C2)SC1=NC(F)(F)F)C3=CC=CC=C3
Synonyms:- (2Z,4E,5Z)-N2,3-Diphenyl-N4,N5-bis(trifluoromethyl)-1,3-thiazolidine-2,4,5-triylidenetriamine
- Benzenamine, N-[3-phenyl-4,5-bis[(trifluoromethyl)imino]-2-thiazolidinylidene]-
- Cropotex
- Flubenzimine
- Flubenzimine (ISO)
- N-[3-Phenyl-4,5-bis[(trifluoromethyl)imino]-2-thiazolidinylidene]benzenamine
- N-{(2Z,4E,5Z)-3-phenyl-4,5-bis[(trifluoromethyl)imino]-1,3-thiazolidin-2-ylidene}aniline
- Slj 0312
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Flubenzimine
CAS:Flubenzimine is a bio-active chemical. Detailed information has not been published.Formula:C17H10F6N4SColor and Shape:SolidMolecular weight:416.34

