CAS 37895-24-2
:7-Methoxy-2H-1,3-benzoxazine-2,4(3H)-dione
Description:
7-Methoxy-2H-1,3-benzoxazine-2,4(3H)-dione, identified by its CAS number 37895-24-2, is a chemical compound that belongs to the class of benzoxazines, which are characterized by a fused benzene and oxazine ring structure. This compound features a methoxy group at the 7-position and two carbonyl groups, contributing to its reactivity and potential applications in various fields. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the methoxy group can influence its electronic properties, making it a candidate for use in organic synthesis and materials science. Additionally, compounds of this class are often studied for their biological activities, including potential antioxidant and antimicrobial properties. The stability and reactivity of 7-Methoxy-2H-1,3-benzoxazine-2,4(3H)-dione can be affected by environmental factors such as pH and temperature, which are important considerations in its handling and application.
Formula:C9H7NO4
InChI:InChI=1S/C9H7NO4/c1-13-5-2-3-6-7(4-5)14-9(12)10-8(6)11/h2-4H,1H3,(H,10,11,12)
InChI key:InChIKey=YFURRWKTIKKJEF-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(OC)=CC2)OC(=O)N1
Synonyms:- 2H-1,3-Benzoxazine-2,4(3H)-dione, 7-methoxy-
- 7-Methoxy-1,3-benzoxazine-2,4-dione
- 7-methoxy-2H-1,3-benzoxazine-2,4(3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
