CymitQuimica logo

CAS 37895-35-5

:

13-amino-4,15,16-trihydroxy-1-methoxy-12-methyl-3,4,8a,13-tetrahydro-2H-chromeno[3',2':6,7][1,3]dioxino[4',5',6':4,5]naphtho[2,1-g]isoquinoline-5,14(1H,9H)-dione

Description:
The chemical substance known as "13-amino-4,15,16-trihydroxy-1-methoxy-12-methyl-3,4,8a,13-tetrahydro-2H-chromeno[3',2':6,7][1,3]dioxino[4',5',6':4,5]naphtho[2,1-g]isoquinoline-5,14(1H,9H)-dione," with the CAS number 37895-35-5, is a complex organic compound characterized by its intricate polycyclic structure. This substance features multiple functional groups, including amino, hydroxy, and methoxy groups, which contribute to its potential biological activity and solubility properties. The presence of these functional groups suggests that it may exhibit various pharmacological effects, possibly acting as a bioactive compound. Its unique chromeno and isoquinoline frameworks indicate potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The compound's stereochemistry and molecular interactions could also play a significant role in its reactivity and biological efficacy. Overall, this substance represents a fascinating area of study within organic and medicinal chemistry, warranting further investigation into its properties and potential applications.
Formula:C27H24N2O9
InChI:InChI=1/C27H24N2O9/c1-9-5-10-6-11-7-14-18-19(15(11)21(31)16(10)27(34)29(9)28)23(33)26-20(25(18)37-8-36-14)22(32)17-12(30)3-4-13(35-2)24(17)38-26/h5-6,12-14,30-31,33H,3-4,7-8,28H2,1-2H3
SMILES:Cc1cc2cc3CC4c5c(c3c(c2c(=O)n1N)O)c(c1c(c(=O)c2C(CCC(c2o1)OC)O)c5OCO4)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.