CAS 379-52-2
:Triphenyltin fluoride
Description:
Triphenyltin fluoride is an organotin compound characterized by the presence of three phenyl groups attached to a tin atom, along with a fluoride ion. It is typically a white to light yellow solid that is sparingly soluble in water but soluble in organic solvents. This compound exhibits a tetrahedral geometry around the tin atom, which is central to its reactivity and interactions. Triphenyltin fluoride is known for its applications in various fields, including as a biocide and in agricultural practices, due to its antifungal and herbicidal properties. However, it is also recognized for its potential environmental and health hazards, as organotin compounds can be toxic to aquatic life and may pose risks to human health upon exposure. Proper handling and disposal are essential to mitigate these risks. Additionally, triphenyltin fluoride can participate in various chemical reactions, making it a subject of interest in synthetic organic chemistry and materials science.
Formula:C18H15FSn
InChI:InChI=1S/3C6H5.FH.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H;/q;;;;+1/p-1
InChI key:InChIKey=JBYRKMGOSFMHRL-UHFFFAOYSA-M
SMILES:[Sn](F)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- Biomet 204
- Caswell No. 896H
- EPA Pesticide Chemical Code 083602
- Fluorotriphenylstannane
- Stannane, fluorotriphenyl-
- Tin triphenylfluoride
- Tin, fluorotriphenyl-
- Triphenylfluorotin
- Triphenyltin fluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Triphenyltin fluoride
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:(C6H5)3SnFMolecular weight:368.99Fluorotriphenylstannane
CAS:FluorotriphenylstannanePurity:98%Color and Shape:White PowderMolecular weight:369.02g/molTriphenyltin fluoride, min. 97%
CAS:Triphenyltin fluoride, min. 97%
Formula:(C6H5)3SnFPurity:min. 97%Color and Shape:white pwdr.Molecular weight:368.99


