CAS 3790-71-4
:(2Z,6E)-Farnesol
Description:
(2Z,6E)-Farnesol is a natural acyclic sesquiterpene alcohol characterized by its distinct structure and properties. It features a long carbon chain with multiple double bonds, specifically configured in a (2Z,6E) arrangement, which influences its reactivity and interactions. This compound is typically colorless to pale yellow and has a pleasant floral scent, making it valuable in the fragrance and flavor industries. (2Z,6E)-Farnesol is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. It is known for its antimicrobial properties and potential applications in cosmetics and personal care products, where it can act as a preservative or skin-conditioning agent. Additionally, it plays a role in various biological processes, including serving as a precursor to other important compounds in plants. Its safety profile is generally favorable, but like many organic compounds, it should be handled with care to avoid irritation or adverse reactions. Overall, (2Z,6E)-Farnesol is a versatile compound with significant industrial and biological relevance.
Formula:C15H26O
InChI:InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11-
InChI key:InChIKey=CRDAMVZIKSXKFV-PVMFERMNSA-N
SMILES:C(=C/CC/C(=C\CO)/C)(\CCC=C(C)C)/C
Synonyms:- 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, (Z,E)-
- (2Z,6E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol
- 2-cis,6-trans-Farnesol
- 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, (2Z,6E)-
- cis,trans-Farnesol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
