CymitQuimica logo

CAS 37901-90-9

:

3-Amino-4-methyl-2-nitrobenzoic acid

Description:
3-Amino-4-methyl-2-nitrobenzoic acid, with the CAS number 37901-90-9, is an organic compound that belongs to the class of amino acids and nitrobenzoic acids. It features an amino group (-NH2), a methyl group (-CH3), and a nitro group (-NO2) attached to a benzoic acid structure. This compound is characterized by its aromatic ring, which contributes to its stability and reactivity. The presence of the amino group makes it a potential candidate for various chemical reactions, including coupling reactions in dye synthesis. The nitro group introduces electrophilic characteristics, allowing for further functionalization. It is typically a solid at room temperature and may exhibit solubility in polar solvents. The compound's properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions. Due to its functional groups, 3-Amino-4-methyl-2-nitrobenzoic acid may have applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Safety data should be consulted for handling and usage, as nitro compounds can be hazardous.
Formula:C8H8N2O4
InChI:InChI=1/C8H8N2O4/c1-4-2-3-5(8(11)12)7(6(4)9)10(13)14/h2-3H,9H2,1H3,(H,11,12)
InChI key:JLWAVVAJFWDXEF-UHFFFAOYSA-N
SMILES:Cc1ccc(c(c1N)N(=O)=O)C(=O)O
Synonyms:
  • Benzoic acid, 3-amino-4-methyl-2-nitro-
Found 4 products.