CAS 37901-92-1

4-(acetylamino)-3-methylbenzoic acid

Description:

4-(Acetylamino)-3-methylbenzoic acid, also known by its CAS number 37901-92-1, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both an acetylamino group and a methyl group. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The acetylamino group contributes to its reactivity and potential applications in various chemical reactions, including acylation and amidation. The methyl group influences the compound's steric properties and can affect its biological activity. This substance may be utilized in pharmaceutical research and development, particularly in the synthesis of drug candidates or as an intermediate in organic synthesis. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is handled. Safety data should be consulted for proper handling and potential hazards associated with this compound.

Formula: C₁₀H₁₁NO₃

InChI: InChI=1/C10H11NO3/c1-6-5-8(10(13)14)3-4-9(6)11-7(2)12/h3-5H,1-2H3,(H,11,12)(H,13,14)

SMILES: Cc1cc(ccc1N=C(C)O)C(=O)O

4-(acetylamino)-3-methylbenzoic acid

CAS: 37901-92-1

Formula: C₁₀H₁₁NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 193.1992

Ref: IN-DA00C8TY

4-Acetamido-3-methylbenzoic acid

CAS: 37901-92-1

4-Acetamido-3-methylbenzoic acid

Purity: 97%

Molecular weight: 193.20g/mol

Ref: 54-OR75820

4-(acetylamino)-3-methylbenzoic acid

CAS: 37901-92-1

Formula: C₁₀H₁₁NO₃

Purity: 97%

Color and Shape: Solid, White powder

Molecular weight: 193.202

Ref: 10-F316297