CAS 37905-07-0
:(5beta,9beta,10alpha,14beta)-8,14:12,16-diepoxyabieta-11,13(15)-dien-16-one
Description:
The chemical substance known as "(5beta,9beta,10alpha,14beta)-8,14:12,16-diepoxyabieta-11,13(15)-dien-16-one," with the CAS number 37905-07-0, is a complex organic compound belonging to the class of terpenoids, specifically a type of abietane. This compound features multiple functional groups, including epoxy groups, which contribute to its reactivity and potential biological activity. Its structure includes a bicyclic framework typical of abietanes, characterized by a fused ring system. The presence of double bonds and epoxide functionalities suggests that it may participate in various chemical reactions, such as nucleophilic attacks or rearrangements. Compounds of this nature are often studied for their potential pharmacological properties, including anti-inflammatory and anticancer activities. Additionally, the stereochemistry indicated by the specific beta and alpha designations suggests that the compound may exhibit unique interactions with biological targets, making it of interest in medicinal chemistry and natural product research. Overall, this compound exemplifies the complexity and diversity found within natural terpenoid structures.
Formula:C20H26O3
InChI:InChI=1/C20H26O3/c1-11-15-12(22-17(11)21)10-14-19(4)8-5-7-18(2,3)13(19)6-9-20(14)16(15)23-20/h10,13-14,16H,5-9H2,1-4H3/t13-,14+,16-,19-,20+/m1/s1
InChI key:InChIKey=OYXDHOVYZKWSRM-PHJMNMFVSA-N
SMILES:C[C@]12[C@]3([C@]4([C@](O4)(C=5C(=C3)OC(=O)C5C)[H])CC[C@@]1(C(C)(C)CCC2)[H])[H]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Jolkinolide A
CAS:Jolkinolide A suppresses tumor growth by reducing VEGF in A549 cells and halting HUVEC proliferation and migration via Akt-STAT3-mTOR pathway inhibition.Formula:C20H26O3Purity:98%Color and Shape:SolidMolecular weight:314.42Jolkinolide A
CAS:<p>Jolkinolide A is a diterpenoid lactone, which is a bioactive compound primarily derived from the plant species Euphorbia fischeriana. It exhibits its mode of action primarily through modulation of various signaling pathways involved in inflammation and cancer. Jolkinolide A is known to inhibit the NF-κB pathway, which plays a crucial role in cellular processes such as immune response, cell proliferation, and apoptosis. Additionally, it has been shown to disrupt the PI3K/Akt signaling pathway, which is often implicated in cancer cell survival and proliferation.</p>Formula:C20H26O3Purity:Min. 95%Molecular weight:314.4 g/mol



