CAS 37905-08-1

Jolkinolide B

Description:

Jolkinolide B is a natural compound classified as a sesquiterpene lactone, primarily derived from the plant species *Jolkinolide* found in certain regions. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties and biological activities. The compound exhibits a range of pharmacological effects, including anti-inflammatory and cytotoxic activities, making it of interest in medicinal chemistry and drug development. Jolkinolide B is known to interact with various biological targets, potentially influencing cellular pathways. Its molecular formula and specific stereochemistry play crucial roles in its reactivity and interaction with biological systems. Additionally, the compound's solubility and stability can vary depending on environmental conditions, which are important factors for its application in research and therapeutic contexts. Overall, Jolkinolide B represents a significant area of study for its potential health benefits and applications in pharmacology.

Formula: C₂₀H₂₆O₄

InChI: InChI=1S/C20H26O4/c1-10-12-14-19(22-14)9-6-11-17(2,3)7-5-8-18(11,4)13(19)15-20(12,23-15)24-16(10)21/h11,13-15H,5-9H2,1-4H3/t11-,13+,14-,15-,18-,19+,20-/m1/s1

InChI key: InChIKey=SOVOCMGDFRGRKF-MCDHERAVSA-N

SMILES: C[C@]12[C@]3([C@]4([C@](O4)(C=5[C@]6([C@@]3(O6)[H])OC(=O)C5C)[H])CC[C@@]1(C(C)(C)CCC2)[H])[H]

Synonyms:

• (4aR,6aS,7aR,10aR,11aR,11bR,11cR)-1,2,3,4,4a,5,6,11a,11b,11c-Decahydro-4,4,8,11c-tetramethylbisoxireno[1,10a:3,4]phenanthro[3,2-b]furan-9(7aH)-one
• Bisoxireno[1,10a:3,4]phenanthro[3,2-b]furan-9(7aH)-one, 1,2,3,4,4a,5,6,11a,11b,11c-decahydro-4,4,8,11c-tetramethyl-, (4aR,6aS,7aR,10aR,11aR,11bR,11cR)-
• Bisoxireno[1,10a:3,4]phenanthro[3,2-b]furan-9(7aH)-one, 1,2,3,4,4a,5,6,11a,11b,11c-decahydro-4,4,8,11c-tetramethyl-, [4aR-(4aα,6aS*,7aβ,10aR*,11aβ,11bα,11cβ)]-
• Jolkinolide B
• bisoxireno[3,4:1,10a]phenanthro[3,2-b]furan-9(7aH)-one, 1,2,3,4,4a,5,6,11a,11b,11c-decahydro-4,4,8,11c-tetramethyl-, (4aR,6aS,7aR,10aR,11aR,11bR,11cR)-

Jolkinolide B

CAS: 37905-08-1

Jolkinolide B

Purity: ≥98%

Molecular weight: 330.42g/mol

Ref: 54-BUP00394

Jolkinolide B

CAS: 37905-08-1

Formula: C₂₀H₂₆O₄

Molecular weight: 330.42

Ref: 7W-GY7934

Jolkinolide B

CAS: 37905-08-1

Formula: C₂₀H₂₆O₄

Purity: 95%~99%

Molecular weight: 330.424

Ref: BP-BP0811

Jolkinolide b

CAS: 37905-08-1

Lactone

Formula: C₂₀H₂₆O₄

Purity: ≥ 90.0 % (HPLC)

Molecular weight: 330.42

Ref: 5G-85754

Jolkinolide B

CAS: 37905-08-1

Jolkinolide B is a diterpenoid compound, which is isolated from the roots of the plant Euphorbia fischeriana, a member of the Euphorbiaceae family. This bioactive compound exhibits a range of pharmacological properties, primarily through its modulation of signaling pathways. Jolkinolide B's mode of action involves the inhibition of NF-kB and STAT3 signaling pathways, both of which are pivotal in regulating inflammation and cancer progression. This compound also induces apoptosis in cancer cells by modulating the expression of various apoptotic proteins.

Formula: C₂₀H₂₆O₄

Purity: Min. 95%

Molecular weight: 330.42 g/mol

Ref: 3D-MBA90508

Jolkinolide B

CAS: 37905-08-1

Jolkinolide B is a bioactive diterpene isolated from the roots of Euphorbia fischeriana Steud.

Formula: C₂₀H₂₆O₄

Purity: 99.39% - 99.7%

Color and Shape: Solid

Molecular weight: 330.42

Ref: TM-T2S1040