CAS 37908-97-7
:3,5-dichloro-4-methoxybenzoic acid
Description:
3,5-Dichloro-4-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of two chlorine atoms and a methoxy group on a benzoic acid framework. The molecular structure features a benzene ring substituted at the 3 and 5 positions with chlorine atoms and at the 4 position with a methoxy group (-OCH3). This compound is typically a white to off-white solid and is soluble in organic solvents, while its solubility in water is limited. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of chlorine atoms can enhance its reactivity and influence its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the methoxy group can affect the compound's electronic properties and steric hindrance, which may impact its interactions in biological systems. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C8H6Cl2O3
InChI:InChI=1/C8H6Cl2O3/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3H,1H3,(H,11,12)
SMILES:COc1c(cc(cc1Cl)C(=O)O)Cl
Synonyms:- Benzoic Acid, 3,5-Dichloro-4-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoic acid, 3,5-dichloro-4-methoxy-
CAS:Formula:C8H6Cl2O3Purity:97%Color and Shape:SolidMolecular weight:221.0374Ref: IN-DA00C8F0
100mgTo inquire250mgTo inquire1g25.00€5g29.00€10g39.00€25g62.00€50g91.00€100g111.00€250g163.00€500g282.00€3,5-Dichloro-4-methoxybenzoic acid
CAS:3,5-Dichloro-4-methoxybenzoic acidFormula:C8H6Cl2O3Purity:97%Color and Shape: off-white solidMolecular weight:221.04g/mol3,5-Dichloro-4-methoxybenzoic acid
CAS:3,5-Dichloro-4-methoxybenzoic acid is a metabolite of 2,4-dichlorobenzoic acid and hydroxybenzoic acid that has been shown to have pharmacokinetic properties similar to those of the parent compounds. 3,5-Dichloro-4-methoxybenzoic acid has been shown to inhibit cell growth in vitro by methylating DNA and interacting with amines and growth regulators. This compound may be used for treatment of cancer cells that are resistant to chemotherapy.Formula:C8H6Cl2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:221.04 g/mol3,5-dichloro-4-methoxybenzoic acid
CAS:Formula:C8H6Cl2O3Purity:97%Color and Shape:Solid, White powderMolecular weight:221.03




