CAS 3791-76-2

1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylpropan-1-one

Description:

1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-phenylpropan-1-one, with the CAS number 3791-76-2, is an organic compound that belongs to the class of chalcones, which are characterized by the presence of a α,β-unsaturated carbonyl system. This compound features a phenylpropanone structure, where a phenyl group is attached to a propanone moiety, along with a hydroxyl group and two methoxy groups on the aromatic ring. The presence of these functional groups contributes to its potential biological activity, including antioxidant and anti-inflammatory properties. The methoxy groups enhance the lipophilicity of the molecule, which may influence its solubility and reactivity. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting the compound's interactions in biological systems. This compound may be of interest in medicinal chemistry and pharmacology for its potential therapeutic applications. However, detailed studies on its specific properties, such as solubility, stability, and biological activity, would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₇H₁₈O₄

InChI: InChI=1/C17H18O4/c1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12/h3-7,10-11,19H,8-9H2,1-2H3

SMILES: COc1cc(c(C(=O)CCc2ccccc2)c(c1)OC)O

Synonyms:

• 1-Propanone, 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenyl-
• Dihydroflavokawain B
• 1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-phenylpropan-1-one

Dihydroflavokawin B

CAS: 3791-76-2

Dihydroflavokawin B is a natural product that can be used as a reference standard. The CAS number of Dihydroflavokawin B is 3791-76-2.

Formula: C₁₇H₁₈O₄

Color and Shape: Solid

Molecular weight: 286.327

Ref: TM-T124931