CAS 379254-21-4

1-Ethyl-2-methyl-1H-benzimidazole-5-carboxylic acid hydrazide

Description:

1-Ethyl-2-methyl-1H-benzimidazole-5-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a benzimidazole core, an ethyl group, and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and benzimidazoles, such as potential biological activity and the ability to form hydrogen bonds due to the presence of the carboxylic acid and hydrazide functionalities. It may be soluble in polar solvents, reflecting the presence of the carboxylic acid group, while its hydrophobic ethyl and methyl substituents can influence its overall solubility and interaction with biological membranes. The compound may also exhibit potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents, owing to the biological relevance of benzimidazole derivatives. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₁H₁₄N₄O

InChI: InChI=1S/C11H14N4O/c1-3-15-7(2)13-9-6-8(11(16)14-12)4-5-10(9)15/h4-6H,3,12H2,1-2H3,(H,14,16)

InChI key: InChIKey=VAXLBFJUHDUIRW-UHFFFAOYSA-N

SMILES: C(C)N1C=2C(=CC(C(NN)=O)=CC2)N=C1C

Synonyms:

• 1H-Benzimidazole-5-carboxylic acid, 1-ethyl-2-methyl-, hydrazide
• 1-Ethyl-2-methyl-1H-benzimidazole-5-carboxylic acid hydrazide

1-Ethyl-2-methyl-1H-1,3-benzodiazole-5-carbohydrazide

Controlled Product

CAS: 379254-21-4

Versatile small molecule scaffold

Formula: C₁₁H₁₄N₄O

Purity: Min. 95%

Molecular weight: 218.26 g/mol

Ref: 3D-EQA25421