CymitQuimica logo

CAS 379254-26-9

:

Benzoic acid, 4-[[(4-methylphenyl)amino]sulfonyl]-

Description:
Benzoic acid, 4-[[(4-methylphenyl)amino]sulfonyl]- is an organic compound characterized by its benzoic acid backbone, which is substituted with a sulfonamide group. This compound features a para-substituted aniline moiety, where a methyl group is attached to the phenyl ring, enhancing its lipophilicity. The sulfonyl group contributes to its potential as a sulfonamide derivative, which may exhibit various biological activities. Typically, compounds of this nature can be involved in pharmaceutical applications, particularly in the development of drugs due to their ability to interact with biological targets. The presence of both acidic and basic functional groups allows for diverse interactions in biological systems, influencing solubility and reactivity. Additionally, the compound may exhibit properties such as antimicrobial or anti-inflammatory effects, common in sulfonamide derivatives. Its molecular structure and functional groups play a crucial role in determining its chemical behavior, stability, and potential applications in medicinal chemistry.
Formula:C14H13NO4S
InChI:InChI=1S/C14H13NO4S/c1-10-2-6-12(7-3-10)15-20(18,19)13-8-4-11(5-9-13)14(16)17/h2-9,15H,1H3,(H,16,17)
InChI key:NWOOPPFGYBXGHY-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)O
Found 3 products.