CAS 379254-72-5

Imidazo[2,1-b]thiazole-6-acetic acid, hydrazide

Description:

Imidazo[2,1-b]thiazole-6-acetic acid, hydrazide is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of nitrogen and sulfur atoms in its structure. The hydrazide functional group suggests that it may participate in various chemical reactions, such as hydrazone formation, which can be relevant in medicinal chemistry. The compound is likely to be soluble in polar solvents, and its reactivity can be influenced by the presence of functional groups that can engage in hydrogen bonding or coordination with metal ions. Additionally, compounds of this nature are often investigated for their pharmacological properties, including antimicrobial, anti-inflammatory, or anticancer activities. As with many heterocycles, the specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which the compound is studied.

Formula: C₇H₈N₄OS

InChI: InChI=1S/C7H8N4OS/c8-10-6(12)3-5-4-11-1-2-13-7(11)9-5/h1-2,4H,3,8H2,(H,10,12)

InChI key: InChIKey=DHUIBZKIXICQHT-UHFFFAOYSA-N

SMILES: C(C(NN)=O)C=1N=C2N(C1)C=CS2

Synonyms:

• Imidazo[2,1-b]thiazole-6-acetic acid, hydrazide

2-{Imidazo[2,1-b][1,3]thiazol-6-yl}acetohydrazide

CAS: 379254-72-5

Versatile small molecule scaffold

Formula: C₇H₈N₄OS

Purity: Min. 95%

Molecular weight: 196.23 g/mol

Ref: 3D-EQA25472