
CAS 379254-79-2
:2-Chloro-N-[4-chloro-3-[(ethylphenylamino)sulfonyl]phenyl]acetamide
Description:
2-Chloro-N-[4-chloro-3-[(ethylphenylamino)sulfonyl]phenyl]acetamide, with the CAS number 379254-79-2, is a synthetic organic compound characterized by its complex structure, which includes a chloroacetamide moiety and a sulfonamide group. This compound typically exhibits properties associated with both amides and sulfonamides, such as moderate solubility in polar solvents and potential bioactivity. The presence of chlorine atoms in its structure may influence its reactivity and stability, while the ethylphenylamino group can enhance its lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its specific applications and mechanisms of action would depend on further research and characterization, including studies on its efficacy and safety profiles. As with many synthetic compounds, proper handling and safety measures should be observed, given the potential hazards associated with its chemical structure.
Formula:C16H16Cl2N2O3S
InChI:InChI=1S/C16H16Cl2N2O3S/c1-2-20(13-6-4-3-5-7-13)24(22,23)15-10-12(8-9-14(15)18)19-16(21)11-17/h3-10H,2,11H2,1H3,(H,19,21)
InChI key:InChIKey=NKSONIUMPUUEIL-UHFFFAOYSA-N
SMILES:S(N(CC)C1=CC=CC=C1)(=O)(=O)C2=CC(NC(CCl)=O)=CC=C2Cl
Synonyms:- 2-Chloro-N-[4-chloro-3-[(ethylphenylamino)sulfonyl]phenyl]acetamide
- Acetamide, 2-chloro-N-[4-chloro-3-[(ethylphenylamino)sulfonyl]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.