CAS 379255-37-5

2-Chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]acetamide

Description:

2-Chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]acetamide is a chemical compound characterized by its specific molecular structure, which includes a chloroacetamide functional group and a trifluoromethyl-substituted phenyl ring. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its polar and non-polar characteristics due to the presence of both halogen and amide functionalities. The presence of chlorine and trifluoromethyl groups contributes to its potential biological activity and lipophilicity, making it of interest in pharmaceutical research. Its molecular weight and specific reactivity can influence its behavior in chemical reactions, particularly in nucleophilic substitutions or coupling reactions. Additionally, the compound may exhibit specific properties such as stability under certain conditions, but it is essential to handle it with care due to potential toxicity associated with halogenated compounds. As with any chemical, proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₉H₆Cl₂F₃NO

InChI: InChI=1S/C9H6Cl2F3NO/c10-4-8(16)15-7-2-1-5(11)3-6(7)9(12,13)14/h1-3H,4H2,(H,15,16)

InChI key: InChIKey=RPDZCNJWMLIHFL-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)C1=C(C(F)(F)F)C=C(Cl)C=C1

Synonyms:

• Acetamide, 2-chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]-
• 2-Chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]acetamide

2-Chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]acetamide

CAS: 379255-37-5

2-Chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]acetamide

Molecular weight: 272.05125g/mol

Ref: 54-PC107049

2-Chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]acetamide

CAS: 379255-37-5

Versatile small molecule scaffold

Formula: C₉H₆Cl₂F₃NO

Purity: Min. 95%

Molecular weight: 272.05 g/mol

Ref: 3D-EQA25537