CAS 379255-73-9

2-[(4-Chlorophenyl)methoxy]benzoic acid hydrazide

Description:

2-[(4-Chlorophenyl)methoxy]benzoic acid hydrazide, with the CAS number 379255-73-9, is a chemical compound characterized by its hydrazide functional group, which is linked to a benzoic acid moiety. This compound features a methoxy group and a para-chlorophenyl substituent, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the hydrazide group suggests potential reactivity, particularly in condensation reactions or as a precursor in the synthesis of more complex molecules. Additionally, the chlorophenyl group may influence the compound's biological activity, making it of interest in pharmaceutical research. Its structural features may also impart specific physical properties, such as melting point and stability under various conditions. Overall, this compound's characteristics make it a subject of interest in both synthetic chemistry and medicinal applications.

Formula: C₁₄H₁₃ClN₂O₂

InChI: InChI=1S/C14H13ClN2O2/c15-11-7-5-10(6-8-11)9-19-13-4-2-1-3-12(13)14(18)17-16/h1-8H,9,16H2,(H,17,18)

InChI key: InChIKey=ZVGRXMCVNCDVBH-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(Cl)C=C1)C2=C(C(NN)=O)C=CC=C2

Synonyms:

• Benzoic acid, 2-[(4-chlorophenyl)methoxy]-, hydrazide
• 2-[(4-Chlorophenyl)methoxy]benzohydrazide
• 2-[(4-Chlorobenzyl)oxy]benzohydrazide
• 2-[(4-Chlorophenyl)methoxy]benzoic acid hydrazide

2-[(4-Chlorophenyl)methoxy]benzohydrazide

CAS: 379255-73-9

Versatile small molecule scaffold

Formula: C₁₄H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 276.72 g/mol

Ref: 3D-EQA25573