CAS 379255-82-0

1,2,3,4-Tetrahydro-4-[(3-nitrophenyl)methylene]-9-acridinecarboxylic acid

Description:

1,2,3,4-Tetrahydro-4-[(3-nitrophenyl)methylene]-9-acridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes an acridine core and a nitrophenyl substituent. This compound features a tetrahydro configuration, indicating the presence of a saturated cyclic structure, and a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The nitrophenyl group introduces electron-withdrawing characteristics, which can influence the compound's electronic properties and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. The presence of multiple functional groups suggests potential for various chemical interactions, including hydrogen bonding and electrophilic substitution. Additionally, the compound's solubility and stability can be affected by the presence of the nitro group and the carboxylic acid, which may also play a role in its pharmacokinetic properties. Overall, this compound represents a unique structure that may have applications in drug development or as a chemical probe in biological studies.

Formula: C₂₁H₁₆N₂O₄

InChI: InChI=1S/C21H16N2O4/c24-21(25)19-16-8-1-2-10-18(16)22-20-14(6-4-9-17(19)20)11-13-5-3-7-15(12-13)23(26)27/h1-3,5,7-8,10-12H,4,6,9H2,(H,24,25)

InChI key: InChIKey=OBICDYRXQOLKBN-UHFFFAOYSA-N

SMILES: C(=C1C=2C(=C(C(O)=O)C=3C(N2)=CC=CC3)CCC1)C4=CC(N(=O)=O)=CC=C4

Synonyms:

• 9-Acridinecarboxylic acid, 1,2,3,4-tetrahydro-4-[(3-nitrophenyl)methylene]-
• 1,2,3,4-Tetrahydro-4-[(3-nitrophenyl)methylene]-9-acridinecarboxylic acid

4-[(3-Nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid

Controlled Product

CAS: 379255-82-0

4-[(3-Nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid is a ligand that binds to and activates the G protein coupled receptor, which has been implicated in the regulation of ion channels. It also inhibits protein interactions with peptides and antibodies. 4-[(3-Nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid is used as a research tool for studying the function of receptors and ion channels.

Formula: C₂₁H₁₆N₂O₄

Purity: Min. 95%

Molecular weight: 360.4 g/mol

Ref: 3D-EQA25582