CAS 37927-29-0: Δ1-Cortienic acid
Description:Δ1-Cortienic acid, with the CAS number 37927-29-0, is a naturally occurring compound that belongs to the class of steroidal compounds. It is characterized by its unique structure, which includes a cyclopentanoperhydrophenanthrene core typical of steroids, along with specific functional groups that contribute to its biological activity. This compound is primarily known for its role in plant physiology, particularly in the biosynthesis of various phytohormones. Δ1-Cortienic acid exhibits properties that may influence growth and developmental processes in plants, acting as a precursor in the synthesis of gibberellins and other important hormones. Its chemical behavior is influenced by the presence of double bonds and functional groups, which can affect its reactivity and interactions with biological systems. Additionally, Δ1-Cortienic acid may have implications in agricultural practices and research, particularly in understanding plant growth regulation and responses to environmental stimuli. Overall, its significance lies in both its structural characteristics and its functional roles in biological systems.
Formula:C20H26O5
InChI:InChI=1S/C20H26O5/c1-18-7-5-12(21)9-11(18)3-4-13-14-6-8-20(25,17(23)24)19(14,2)10-15(22)16(13)18/h5,7,9,13-16,22,25H,3-4,6,8,10H2,1-2H3,(H,23,24)/t13-,14-,15-,16+,18-,19-,20-/m0/s1
InChI key:InChIKey=MCKJPJYRCPANCC-XLXYOEISSA-N
SMILES:O=C1C=CC2(C(=C1)CCC3C4CCC(O)(C(=O)O)C4(C)CC(O)C32)C
- Synonyms:
- (11beta,17alpha)-11,17-Dihydroxy-3-oxoandrosta-1,4-diene-17-carboxylic acid
- 11beta,17alpha-Dihydroxy-3-oxoandrost-1,4-diene-17-carboxylic acid
- 11β,17-Dihydroxy-3-oxoandrosta-1,4-diene-17β-carboxylic acid
- 11β,17α-Dihydroxyandrosta-1,4-dien-3-one-17β-carboxylic acid
- Androsta-1,4-diene-17-carboxylic acid, 11,17-dihydroxy-3-oxo-, (11β,17α)-
- Pj 90
- Prednienic acid
- Δ<sup>1</sup>-Cortienic acid
- Δ1-Cortienic acid
- (11β,17α)-11,17-Dihydroxy-3-oxoandrosta-1,4-diene-17-carboxylic acid
- See more synonyms
