CAS 3795-79-7

methyl 4-(methylsulfanyl)benzoate

Description:

Methyl 4-(methylsulfanyl)benzoate, with the CAS number 3795-79-7, is an organic compound that belongs to the class of benzoate esters. It features a methyl group and a methylthio group attached to a benzoate structure, which contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. Methyl 4-(methylsulfanyl)benzoate is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its chemical structure allows for potential reactivity in nucleophilic substitution reactions, making it a valuable compound in synthetic organic chemistry. Additionally, it may exhibit biological activity, although specific biological properties would require further investigation. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₉H₁₀O₂S

InChI: InChI=1/C9H10O2S/c1-11-9(10)7-3-5-8(12-2)6-4-7/h3-6H,1-2H3

SMILES: COC(=O)c1ccc(cc1)SC

Synonyms:

• Benzoic acid, 4-(methylthio)-, methyl ester
• Methyl 4-(methylsulfanyl)benzoate

methyl 4-methylsulfanylbenzoate

CAS: 3795-79-7

Formula: C₉H₁₀O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 182.2395

Ref: IN-DA003RTY

methyl 4-(methylthio)benzoate

CAS: 3795-79-7

methyl 4-(methylthio)benzoate

Purity: ≥95%

Ref: 54-OR27654

Methyl 4-(Methylthio)benzoate

Controlled Product

CAS: 3795-79-7

Stability Store in Freezer, Sensitive to Oxidation
Applications A useful synthetic intermediate.

Formula: C₉H₁₀O₂S

Color and Shape: Off-White

Molecular weight: 182.24

Ref: TR-M323015