CAS 3796-24-5
:4-(trifluoromethyl)pyridine
Description:
4-(Trifluoromethyl)pyridine is an aromatic heterocyclic compound characterized by the presence of a pyridine ring substituted with a trifluoromethyl group at the 4-position. Its molecular formula is C6H4F3N, and it features a nitrogen atom within the six-membered ring, contributing to its basicity and potential reactivity. The trifluoromethyl group is known for its electron-withdrawing properties, which can influence the compound's chemical behavior, making it less nucleophilic compared to unsubstituted pyridine. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature, and it has a distinctive odor. It is soluble in organic solvents and has applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, 4-(trifluoromethyl)pyridine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.
Formula:C6H4F3N
InChI:InChI=1S/C6H4F3N/c7-6(8,9)5-1-3-10-4-2-5/h1-4H
InChI key:InChIKey=IIYVNMXPYWIJBL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=CN=CC1
Synonyms:- Pyridine, 4-(trifluoromethyl)-
- alpha,alpha,alpha-Trifluoro-4-picoline
- 4-(Trifluoromethyl)pyridine
- 4-(Trifluoromethyl)pyridine 95%
- à,à,à-trifluoro-4-picoline
- 4-(Trifluoromethyl)pyridine95%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(Trifluoromethyl)pyridine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H4F3NPurity:97%Color and Shape:Liquid, Clear colorlessMolecular weight:147.104-(Trifluoromethyl)pyridine
CAS:Formula:C6H4F3NPurity:98%Color and Shape:LiquidMolecular weight:147.09794-(Trifluoromethyl)pyridine
CAS:4-(Trifluoromethyl)pyridineFormula:C6H4F3NPurity:≥95%Color and Shape: clear. colourless liquidMolecular weight:147.10g/mol4-(Trifluoromethyl)pyridine
CAS:Formula:C6H4F3NPurity:98%Color and Shape:LiquidMolecular weight:147.14-(Trifluoromethyl)pyridine
CAS:4-(Trifluoromethyl)pyridine is a functional group that has been shown to induce apoptotic cell death in the presence of hydrogen peroxide. 4-Pyridinecarboxylate, a reaction product of this functional group, is an intermediate in the synthesis of pharmaceuticals and agrochemicals. It has minimal activity as a base but reacts synergistically with other bases such as sodium methoxide or potassium tert-butoxide. The yield of 4-(trifluoromethyl)pyridine can be increased by reacting it with chloroform in an isolated environment. This chemical has been shown to have biological properties and may be used to treat various diseases such as cancer and malaria. The nitrogen atoms in this compound are responsible for its biological activity.Formula:C6H4F3NPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:147.1 g/mol





